C18H25NO4 — CID 111115760
N-(3-ethyl-2-hydroxypentyl)-5-methoxy-2-methyl-1-benzofuran-3-carboxamide (PubChem CID 111115760) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is N-(3-ethyl-2-hydroxypentyl)-5-methoxy-2-methyl-1-benzofuran-3-carboxamide.
| Compound Name | N-(3-ethyl-2-hydroxypentyl)-5-methoxy-2-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 111115760 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | N-(3-ethyl-2-hydroxypentyl)-5-methoxy-2-methyl-1-benzofuran-3-carboxamide |
| SMILES | CCC(CC)C(O)CNC(=O)c1c(C)oc2ccc(OC)cc12 |
| InChI | InChI=1S/C18H25NO4/c1-5-12(6-2)15(20)10-19-18(21)17-11(3)23-16-8-7-13(22-4)9-14(16)17/h7-9,12,15,20H,5-6,10H2,1-4H3,(H,19,21) |
| InChIKey | ZJYVHYNVVVDERO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |