C17H21NO4 — CID 111331196
N-[(1-hydroxycyclopentyl)methyl]-5-methoxy-2-methyl-1-benzofuran-3-carboxamide (PubChem CID 111331196) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-[(1-hydroxycyclopentyl)methyl]-5-methoxy-2-methyl-1-benzofuran-3-carboxamide.
| Compound Name | N-[(1-hydroxycyclopentyl)methyl]-5-methoxy-2-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 111331196 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | N-[(1-hydroxycyclopentyl)methyl]-5-methoxy-2-methyl-1-benzofuran-3-carboxamide |
| SMILES | COc1ccc2oc(C)c(C(=O)NCC3(O)CCCC3)c2c1 |
| InChI | InChI=1S/C17H21NO4/c1-11-15(13-9-12(21-2)5-6-14(13)22-11)16(19)18-10-17(20)7-3-4-8-17/h5-6,9,20H,3-4,7-8,10H2,1-2H3,(H,18,19) |
| InChIKey | GWPVKEMFYOJAOT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |