C21H23NO4 — CID 55789548
5-methoxy-2-methyl-N-[3-(3-methylphenoxy)propyl]-1-benzofuran-3-carboxamide (PubChem CID 55789548) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 5-methoxy-2-methyl-N-[3-(3-methylphenoxy)propyl]-1-benzofuran-3-carboxamide.
| Compound Name | 5-methoxy-2-methyl-N-[3-(3-methylphenoxy)propyl]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 55789548 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 5-methoxy-2-methyl-N-[3-(3-methylphenoxy)propyl]-1-benzofuran-3-carboxamide |
| SMILES | COc1ccc2oc(C)c(C(=O)NCCCOc3cccc(C)c3)c2c1 |
| InChI | InChI=1S/C21H23NO4/c1-14-6-4-7-17(12-14)25-11-5-10-22-21(23)20-15(2)26-19-9-8-16(24-3)13-18(19)20/h4,6-9,12-13H,5,10-11H2,1-3H3,(H,22,23) |
| InChIKey | QZQFIIIQZBNNSY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|