C19H18ClNO4 — CID 55793954
N-[2-(3-chlorophenoxy)ethyl]-5-methoxy-2-methyl-1-benzofuran-3-carboxamide (PubChem CID 55793954) has the molecular formula C19H18ClNO4 and a molecular weight of 359.81 g/mol. Its IUPAC name is N-[2-(3-chlorophenoxy)ethyl]-5-methoxy-2-methyl-1-benzofuran-3-carboxamide.
| Compound Name | N-[2-(3-chlorophenoxy)ethyl]-5-methoxy-2-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 55793954 |
| Molecular Formula | C19H18ClNO4 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-[2-(3-chlorophenoxy)ethyl]-5-methoxy-2-methyl-1-benzofuran-3-carboxamide |
| SMILES | COc1ccc2oc(C)c(C(=O)NCCOc3cccc(Cl)c3)c2c1 |
| InChI | InChI=1S/C19H18ClNO4/c1-12-18(16-11-14(23-2)6-7-17(16)25-12)19(22)21-8-9-24-15-5-3-4-13(20)10-15/h3-7,10-11H,8-9H2,1-2H3,(H,21,22) |
| InChIKey | GSOYJACTPGZTQJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|