C12H18ClNO2 — CID 177170822
N-[2-(3-chlorophenoxy)ethyl]acetamide;ethane (PubChem CID 177170822) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is N-[2-(3-chlorophenoxy)ethyl]acetamide;ethane.
| Compound Name | N-[2-(3-chlorophenoxy)ethyl]acetamide;ethane |
|---|---|
| PubChem CID | 177170822 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-[2-(3-chlorophenoxy)ethyl]acetamide;ethane |
| SMILES | CC.CC(=O)NCCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C10H12ClNO2.C2H6/c1-8(13)12-5-6-14-10-4-2-3-9(11)7-10;1-2/h2-4,7H,5-6H2,1H3,(H,12,13);1-2H3 |
| InChIKey | WQGIBCZPDOCQNZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|