C10H14Cl2N2O2 — CID 119295694
2-amino-N-[2-(3-chlorophenoxy)ethyl]acetamide;hydrochloride (PubChem CID 119295694) has the molecular formula C10H14Cl2N2O2 and a molecular weight of 265.14 g/mol. Its IUPAC name is 2-amino-N-[2-(3-chlorophenoxy)ethyl]acetamide;hydrochloride.
| Compound Name | 2-amino-N-[2-(3-chlorophenoxy)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119295694 |
| Molecular Formula | C10H14Cl2N2O2 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2-amino-N-[2-(3-chlorophenoxy)ethyl]acetamide;hydrochloride |
| SMILES | Cl.NCC(=O)NCCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C10H13ClN2O2.ClH/c11-8-2-1-3-9(6-8)15-5-4-13-10(14)7-12;/h1-3,6H,4-5,7,12H2,(H,13,14);1H |
| InChIKey | REYFSZDPZXTRPT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|