C14H22Cl2N2O2 — CID 119735014
(2S)-2-amino-N-[2-(3-chlorophenoxy)ethyl]-4-methylpentanamide;hydrochloride (PubChem CID 119735014) has the molecular formula C14H22Cl2N2O2 and a molecular weight of 321.25 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(3-chlorophenoxy)ethyl]-4-methylpentanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[2-(3-chlorophenoxy)ethyl]-4-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119735014 |
| Molecular Formula | C14H22Cl2N2O2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (2S)-2-amino-N-[2-(3-chlorophenoxy)ethyl]-4-methylpentanamide;hydrochloride |
| SMILES | CC(C)C[C@H](N)C(=O)NCCOc1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C14H21ClN2O2.ClH/c1-10(2)8-13(16)14(18)17-6-7-19-12-5-3-4-11(15)9-12;/h3-5,9-10,13H,6-8,16H2,1-2H3,(H,17,18);1H/t13-;/m0./s1 |
| InChIKey | AEBOYPCDGZSAOE-ZOWNYOTGSA-N |
| XLogP | 2.63 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|