C17H19ClN2O2 — CID 112970797
1-[2-(3-chlorophenoxy)ethyl]-3-(3,4-dimethylphenyl)urea (PubChem CID 112970797) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 1-[2-(3-chlorophenoxy)ethyl]-3-(3,4-dimethylphenyl)urea.
| Compound Name | 1-[2-(3-chlorophenoxy)ethyl]-3-(3,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 112970797 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 1-[2-(3-chlorophenoxy)ethyl]-3-(3,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCCOc2cccc(Cl)c2)cc1C |
| InChI | InChI=1S/C17H19ClN2O2/c1-12-6-7-15(10-13(12)2)20-17(21)19-8-9-22-16-5-3-4-14(18)11-16/h3-7,10-11H,8-9H2,1-2H3,(H2,19,20,21) |
| InChIKey | RFDJSIJHHFCABU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|