C12H19NO3 — CID 114821770
N-(2-ethyl-2-hydroxybutyl)-5-methylfuran-3-carboxamide (PubChem CID 114821770) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is N-(2-ethyl-2-hydroxybutyl)-5-methylfuran-3-carboxamide.
| Compound Name | N-(2-ethyl-2-hydroxybutyl)-5-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 114821770 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | N-(2-ethyl-2-hydroxybutyl)-5-methylfuran-3-carboxamide |
| SMILES | CCC(O)(CC)CNC(=O)c1coc(C)c1 |
| InChI | InChI=1S/C12H19NO3/c1-4-12(15,5-2)8-13-11(14)10-6-9(3)16-7-10/h6-7,15H,4-5,8H2,1-3H3,(H,13,14) |
| InChIKey | BXMZQJGPNWQRGO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |