C11H18N2O2 — CID 114818535
N-(3-amino-2,2-dimethylpropyl)-5-methylfuran-3-carboxamide (PubChem CID 114818535) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-5-methylfuran-3-carboxamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-5-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 114818535 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-5-methylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(C)(C)CN)co1 |
| InChI | InChI=1S/C11H18N2O2/c1-8-4-9(5-15-8)10(14)13-7-11(2,3)6-12/h4-5H,6-7,12H2,1-3H3,(H,13,14) |
| InChIKey | SETYYDRHVBYLML-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |