C10H14ClNO2 — CID 114823198
N-(1-chloro-2-methylpropan-2-yl)-5-methylfuran-3-carboxamide (PubChem CID 114823198) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is N-(1-chloro-2-methylpropan-2-yl)-5-methylfuran-3-carboxamide.
| Compound Name | N-(1-chloro-2-methylpropan-2-yl)-5-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 114823198 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | N-(1-chloro-2-methylpropan-2-yl)-5-methylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC(C)(C)CCl)co1 |
| InChI | InChI=1S/C10H14ClNO2/c1-7-4-8(5-14-7)9(13)12-10(2,3)6-11/h4-5H,6H2,1-3H3,(H,12,13) |
| InChIKey | QZQOTAOCTGTHNZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|