C13H19NO4 — CID 114822096
methyl 2-methyl-2-[(5-methylfuran-3-carbonyl)amino]pentanoate (PubChem CID 114822096) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is methyl 2-methyl-2-[(5-methylfuran-3-carbonyl)amino]pentanoate.
| Compound Name | methyl 2-methyl-2-[(5-methylfuran-3-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 114822096 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | methyl 2-methyl-2-[(5-methylfuran-3-carbonyl)amino]pentanoate |
| SMILES | CCCC(C)(NC(=O)c1coc(C)c1)C(=O)OC |
| InChI | InChI=1S/C13H19NO4/c1-5-6-13(3,12(16)17-4)14-11(15)10-7-9(2)18-8-10/h7-8H,5-6H2,1-4H3,(H,14,15) |
| InChIKey | WWQFWLBWERHLLL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |