C14H11Br2NO3S — CID 103790121
4-[2-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]benzoic acid (PubChem CID 103790121) has the molecular formula C14H11Br2NO3S and a molecular weight of 433.12 g/mol. Its IUPAC name is 4-[2-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 103790121 |
| Molecular Formula | C14H11Br2NO3S |
| Molecular Weight | 433.12 g/mol |
| Exact Mass | 430.88 |
| IUPAC Name | 4-[2-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCNC(=O)c2cc(Br)sc2Br)cc1 |
| InChI | InChI=1S/C14H11Br2NO3S/c15-11-7-10(12(16)21-11)13(18)17-6-5-8-1-3-9(4-2-8)14(19)20/h1-4,7H,5-6H2,(H,17,18)(H,19,20) |
| InChIKey | CSVIOFAFRHYRNY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.12 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |