C9H14N2O3 — CID 90573751
N-butyl-3-methoxy-1,2-oxazole-5-carboxamide (PubChem CID 90573751) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is N-butyl-3-methoxy-1,2-oxazole-5-carboxamide.
| Compound Name | N-butyl-3-methoxy-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 90573751 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | N-butyl-3-methoxy-1,2-oxazole-5-carboxamide |
| SMILES | CCCCNC(=O)c1cc(OC)no1 |
| InChI | InChI=1S/C9H14N2O3/c1-3-4-5-10-9(12)7-6-8(13-2)11-14-7/h6H,3-5H2,1-2H3,(H,10,12) |
| InChIKey | JKHZDMUCYMXYSB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|