C7H7NO5 — CID 15923592
methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate (PubChem CID 15923592) has the molecular formula C7H7NO5 and a molecular weight of 185.13 g/mol. Its IUPAC name is methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate.
| Compound Name | methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 15923592 |
| Molecular Formula | C7H7NO5 |
| Molecular Weight | 185.13 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate |
| SMILES | COC(=O)C(=O)c1cc(OC)no1 |
| InChI | InChI=1S/C7H7NO5/c1-11-5-3-4(13-8-5)6(9)7(10)12-2/h3H,1-2H3 |
| InChIKey | DDSXGYFLQWGPLO-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.13 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|