methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate

C7H7NO5 — CID 15923592

IUPACmethyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate
SMILESCOC(=O)C(=O)c1cc(OC)no1
InChIInChI=1S/C7H7NO5/c1-11-5-3-4(13-8-5)6(9)7(10)12-2/h3H,1-2H3
InChIKeyDDSXGYFLQWGPLO-UHFFFAOYSA-N
MW185.13 g/mol
LogP0.04
Rot. Bonds3

About methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate

methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate (PubChem CID 15923592) has the molecular formula C7H7NO5 and a molecular weight of 185.13 g/mol. Its IUPAC name is methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate.

Molecular Properties

Compound Namemethyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate
PubChem CID15923592
Molecular FormulaC7H7NO5
Molecular Weight185.13 g/mol
Exact Mass185.03
IUPAC Namemethyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate
SMILESCOC(=O)C(=O)c1cc(OC)no1
InChIInChI=1S/C7H7NO5/c1-11-5-3-4(13-8-5)6(9)7(10)12-2/h3H,1-2H3
InChIKeyDDSXGYFLQWGPLO-UHFFFAOYSA-N
XLogP0.04
TPSA78.63 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.13
LogP ≤ 50.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate?
The IUPAC name of methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate (CID 15923592) is methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate.
What is the SMILES notation for methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate?
The canonical SMILES for methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate is COC(=O)C(=O)c1cc(OC)no1.
What is the InChIKey of methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate?
The InChIKey is DDSXGYFLQWGPLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO5/c1-11-5-3-4(13-8-5)6(9)7(10)12-2/h3H,1-2H3.
What are the key properties of methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate?
methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate has a molecular weight of 185.13 g/mol, XLogP of 0.04, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-methoxy-1,2-oxazol-5-yl)-2-oxoacetate is sourced from PubChem (CID 15923592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).