About 3-methoxy-N,N-di(propan-2-yl)-1,2-oxazole-5-carboxamide
3-methoxy-N,N-di(propan-2-yl)-1,2-oxazole-5-carboxamide (PubChem CID 90573695) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is 3-methoxy-N,N-di(propan-2-yl)-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-methoxy-N,N-di(propan-2-yl)-1,2-oxazole-5-carboxamide |
| PubChem CID | 90573695 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 3-methoxy-N,N-di(propan-2-yl)-1,2-oxazole-5-carboxamide |
| SMILES | COc1cc(C(=O)N(C(C)C)C(C)C)on1 |
| InChI | InChI=1S/C11H18N2O3/c1-7(2)13(8(3)4)11(14)9-6-10(15-5)12-16-9/h6-8H,1-5H3 |
| InChIKey | SGLYGUMCIFWQSM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methoxy-N,N-di(propan-2-yl)-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N,N-di(propan-2-yl)-1,2-oxazole-5-carboxamide?
The IUPAC name of 3-methoxy-N,N-di(propan-2-yl)-1,2-oxazole-5-carboxamide (CID 90573695) is 3-methoxy-N,N-di(propan-2-yl)-1,2-oxazole-5-carboxamide.
What is the SMILES notation for 3-methoxy-N,N-di(propan-2-yl)-1,2-oxazole-5-carboxamide?
The canonical SMILES for 3-methoxy-N,N-di(propan-2-yl)-1,2-oxazole-5-carboxamide is COc1cc(C(=O)N(C(C)C)C(C)C)on1.
What is the InChIKey of 3-methoxy-N,N-di(propan-2-yl)-1,2-oxazole-5-carboxamide?
The InChIKey is SGLYGUMCIFWQSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-7(2)13(8(3)4)11(14)9-6-10(15-5)12-16-9/h6-8H,1-5H3.
What are the key properties of 3-methoxy-N,N-di(propan-2-yl)-1,2-oxazole-5-carboxamide?
3-methoxy-N,N-di(propan-2-yl)-1,2-oxazole-5-carboxamide has a molecular weight of 226.28 g/mol, XLogP of 1.94, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N,N-di(propan-2-yl)-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 90573695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).