C7H8N2O5 — CID 120513531
2-[(3-methoxy-1,2-oxazole-5-carbonyl)amino]acetic acid (PubChem CID 120513531) has the molecular formula C7H8N2O5 and a molecular weight of 200.15 g/mol. Its IUPAC name is 2-[(3-methoxy-1,2-oxazole-5-carbonyl)amino]acetic acid.
| Compound Name | 2-[(3-methoxy-1,2-oxazole-5-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 120513531 |
| Molecular Formula | C7H8N2O5 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 2-[(3-methoxy-1,2-oxazole-5-carbonyl)amino]acetic acid |
| SMILES | COc1cc(C(=O)NCC(=O)O)on1 |
| InChI | InChI=1S/C7H8N2O5/c1-13-5-2-4(14-9-5)7(12)8-3-6(10)11/h2H,3H2,1H3,(H,8,12)(H,10,11) |
| InChIKey | CDSVSIXQMFJVPC-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |