C12H11ClN2O3 — CID 71802436
N-[(2-chlorophenyl)methyl]-3-methoxy-1,2-oxazole-5-carboxamide (PubChem CID 71802436) has the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-3-methoxy-1,2-oxazole-5-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-3-methoxy-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 71802436 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-3-methoxy-1,2-oxazole-5-carboxamide |
| SMILES | COc1cc(C(=O)NCc2ccccc2Cl)on1 |
| InChI | InChI=1S/C12H11ClN2O3/c1-17-11-6-10(18-15-11)12(16)14-7-8-4-2-3-5-9(8)13/h2-6H,7H2,1H3,(H,14,16) |
| InChIKey | HEDXIYJOEKUJPF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |