C13H22N2O3 — CID 97353224
3-methoxy-N-[(2R)-octan-2-yl]-1,2-oxazole-5-carboxamide (PubChem CID 97353224) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-methoxy-N-[(2R)-octan-2-yl]-1,2-oxazole-5-carboxamide.
| Compound Name | 3-methoxy-N-[(2R)-octan-2-yl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 97353224 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 3-methoxy-N-[(2R)-octan-2-yl]-1,2-oxazole-5-carboxamide |
| SMILES | CCCCCC[C@@H](C)NC(=O)c1cc(OC)no1 |
| InChI | InChI=1S/C13H22N2O3/c1-4-5-6-7-8-10(2)14-13(16)11-9-12(17-3)15-18-11/h9-10H,4-8H2,1-3H3,(H,14,16)/t10-/m1/s1 |
| InChIKey | CTCDXXCQCDCFBU-SNVBAGLBSA-N |
| XLogP | 2.77 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|