C15H18N2O4 — CID 90574079
N-(3-methoxypropyl)-3-phenylmethoxy-1,2-oxazole-5-carboxamide (PubChem CID 90574079) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-(3-methoxypropyl)-3-phenylmethoxy-1,2-oxazole-5-carboxamide.
| Compound Name | N-(3-methoxypropyl)-3-phenylmethoxy-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 90574079 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-(3-methoxypropyl)-3-phenylmethoxy-1,2-oxazole-5-carboxamide |
| SMILES | COCCCNC(=O)c1cc(OCc2ccccc2)no1 |
| InChI | InChI=1S/C15H18N2O4/c1-19-9-5-8-16-15(18)13-10-14(17-21-13)20-11-12-6-3-2-4-7-12/h2-4,6-7,10H,5,8-9,11H2,1H3,(H,16,18) |
| InChIKey | NSRBWFYNTQYQMR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|