C21H19N3O3 — CID 90574118
N-[2-(1H-indol-3-yl)ethyl]-3-phenylmethoxy-1,2-oxazole-5-carboxamide (PubChem CID 90574118) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-3-phenylmethoxy-1,2-oxazole-5-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-3-phenylmethoxy-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 90574118 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-3-phenylmethoxy-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)c1cc(OCc2ccccc2)no1 |
| InChI | InChI=1S/C21H19N3O3/c25-21(22-11-10-16-13-23-18-9-5-4-8-17(16)18)19-12-20(24-27-19)26-14-15-6-2-1-3-7-15/h1-9,12-13,23H,10-11,14H2,(H,22,25) |
| InChIKey | HARHQXBULJHTFA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |