C9H12N2O2 — CID 114618847
3-methyl-N-(2-methylprop-2-enyl)-1,2-oxazole-5-carboxamide (PubChem CID 114618847) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 3-methyl-N-(2-methylprop-2-enyl)-1,2-oxazole-5-carboxamide.
| Compound Name | 3-methyl-N-(2-methylprop-2-enyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 114618847 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 3-methyl-N-(2-methylprop-2-enyl)-1,2-oxazole-5-carboxamide |
| SMILES | C=C(C)CNC(=O)c1cc(C)no1 |
| InChI | InChI=1S/C9H12N2O2/c1-6(2)5-10-9(12)8-4-7(3)11-13-8/h4H,1,5H2,2-3H3,(H,10,12) |
| InChIKey | MTSMUAQWJUHJLS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|