C18H22Cl2N4O2 — CID 119391714
3-(2,6-dichlorophenyl)-5-methyl-N-(3-piperazin-1-ylpropyl)-1,2-oxazole-4-carboxamide (PubChem CID 119391714) has the molecular formula C18H22Cl2N4O2 and a molecular weight of 397.31 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-5-methyl-N-(3-piperazin-1-ylpropyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2,6-dichlorophenyl)-5-methyl-N-(3-piperazin-1-ylpropyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 119391714 |
| Molecular Formula | C18H22Cl2N4O2 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-5-methyl-N-(3-piperazin-1-ylpropyl)-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)NCCCN1CCNCC1 |
| InChI | InChI=1S/C18H22Cl2N4O2/c1-12-15(17(23-26-12)16-13(19)4-2-5-14(16)20)18(25)22-6-3-9-24-10-7-21-8-11-24/h2,4-5,21H,3,6-11H2,1H3,(H,22,25) |
| InChIKey | KQPCDNTVLPUEDB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|