C25H30N4O3 — CID 142679500
N-[[3-(1,3-benzodioxol-5-yl)-1,2-oxazol-5-yl]methyl]-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethanamine (PubChem CID 142679500) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[[3-(1,3-benzodioxol-5-yl)-1,2-oxazol-5-yl]methyl]-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethanamine.
| Compound Name | N-[[3-(1,3-benzodioxol-5-yl)-1,2-oxazol-5-yl]methyl]-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethanamine |
|---|---|
| PubChem CID | 142679500 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-[[3-(1,3-benzodioxol-5-yl)-1,2-oxazol-5-yl]methyl]-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethanamine |
| SMILES | Cc1ccc(N2CCN(CCNCc3cc(-c4ccc5c(c4)OCO5)no3)CC2)c(C)c1 |
| InChI | InChI=1S/C25H30N4O3/c1-18-3-5-23(19(2)13-18)29-11-9-28(10-12-29)8-7-26-16-21-15-22(27-32-21)20-4-6-24-25(14-20)31-17-30-24/h3-6,13-15,26H,7-12,16-17H2,1-2H3 |
| InChIKey | UWNTUZVILHYPQK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|