C23H24F4N4O2 — CID 142679914
2-[4-(4-fluorophenyl)piperazin-1-yl]-N-[[3-[4-(trifluoromethoxy)phenyl]-1,2-oxazol-5-yl]methyl]ethanamine (PubChem CID 142679914) has the molecular formula C23H24F4N4O2 and a molecular weight of 464.46 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)piperazin-1-yl]-N-[[3-[4-(trifluoromethoxy)phenyl]-1,2-oxazol-5-yl]methyl]ethanamine.
| Compound Name | 2-[4-(4-fluorophenyl)piperazin-1-yl]-N-[[3-[4-(trifluoromethoxy)phenyl]-1,2-oxazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 142679914 |
| Molecular Formula | C23H24F4N4O2 |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 2-[4-(4-fluorophenyl)piperazin-1-yl]-N-[[3-[4-(trifluoromethoxy)phenyl]-1,2-oxazol-5-yl]methyl]ethanamine |
| SMILES | Fc1ccc(N2CCN(CCNCc3cc(-c4ccc(OC(F)(F)F)cc4)no3)CC2)cc1 |
| InChI | InChI=1S/C23H24F4N4O2/c24-18-3-5-19(6-4-18)31-13-11-30(12-14-31)10-9-28-16-21-15-22(29-33-21)17-1-7-20(8-2-17)32-23(25,26)27/h1-8,15,28H,9-14,16H2 |
| InChIKey | OLPSDAWKMNRRGX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|