C27H32FN3O2 — CID 137460082
2-[4-[4-(3,4-dimethoxyphenyl)phenyl]piperazin-1-yl]-N-[(4-fluorophenyl)methyl]ethanamine (PubChem CID 137460082) has the molecular formula C27H32FN3O2 and a molecular weight of 449.57 g/mol. Its IUPAC name is 2-[4-[4-(3,4-dimethoxyphenyl)phenyl]piperazin-1-yl]-N-[(4-fluorophenyl)methyl]ethanamine.
| Compound Name | 2-[4-[4-(3,4-dimethoxyphenyl)phenyl]piperazin-1-yl]-N-[(4-fluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 137460082 |
| Molecular Formula | C27H32FN3O2 |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 2-[4-[4-(3,4-dimethoxyphenyl)phenyl]piperazin-1-yl]-N-[(4-fluorophenyl)methyl]ethanamine |
| SMILES | COc1ccc(-c2ccc(N3CCN(CCNCc4ccc(F)cc4)CC3)cc2)cc1OC |
| InChI | InChI=1S/C27H32FN3O2/c1-32-26-12-7-23(19-27(26)33-2)22-5-10-25(11-6-22)31-17-15-30(16-18-31)14-13-29-20-21-3-8-24(28)9-4-21/h3-12,19,29H,13-18,20H2,1-2H3 |
| InChIKey | YSFNYGISQUAESS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|