C20H26FN3O3S — CID 42267714
N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-methoxy-5-methylbenzenesulfonamide (PubChem CID 42267714) has the molecular formula C20H26FN3O3S and a molecular weight of 407.51 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-methoxy-5-methylbenzenesulfonamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-methoxy-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 42267714 |
| Molecular Formula | C20H26FN3O3S |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-methoxy-5-methylbenzenesulfonamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)NCCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H26FN3O3S/c1-16-3-8-19(27-2)20(15-16)28(25,26)22-9-10-23-11-13-24(14-12-23)18-6-4-17(21)5-7-18/h3-8,15,22H,9-14H2,1-2H3 |
| InChIKey | GXGTVNJEJKILGF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |