C23H29FN4O4 — CID 167925450
N'-[(2,4-dimethoxyphenyl)methyl]-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]oxamide (PubChem CID 167925450) has the molecular formula C23H29FN4O4 and a molecular weight of 444.51 g/mol. Its IUPAC name is N'-[(2,4-dimethoxyphenyl)methyl]-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]oxamide.
| Compound Name | N'-[(2,4-dimethoxyphenyl)methyl]-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 167925450 |
| Molecular Formula | C23H29FN4O4 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N'-[(2,4-dimethoxyphenyl)methyl]-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]oxamide |
| SMILES | COc1ccc(CNC(=O)C(=O)NCCN2CCN(c3ccc(F)cc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C23H29FN4O4/c1-31-20-8-3-17(21(15-20)32-2)16-26-23(30)22(29)25-9-10-27-11-13-28(14-12-27)19-6-4-18(24)5-7-19/h3-8,15H,9-14,16H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | GWLRSHZPHSGVBI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|