C23H26FN5O3 — CID 167910543
N'-[[4-(cyanomethoxy)phenyl]methyl]-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]oxamide (PubChem CID 167910543) has the molecular formula C23H26FN5O3 and a molecular weight of 439.49 g/mol. Its IUPAC name is N'-[[4-(cyanomethoxy)phenyl]methyl]-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]oxamide.
| Compound Name | N'-[[4-(cyanomethoxy)phenyl]methyl]-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 167910543 |
| Molecular Formula | C23H26FN5O3 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | N'-[[4-(cyanomethoxy)phenyl]methyl]-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]oxamide |
| SMILES | N#CCOc1ccc(CNC(=O)C(=O)NCCN2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H26FN5O3/c24-19-3-5-20(6-4-19)29-14-12-28(13-15-29)11-10-26-22(30)23(31)27-17-18-1-7-21(8-2-18)32-16-9-25/h1-8H,10-17H2,(H,26,30)(H,27,31) |
| InChIKey | FEMQNCJFQOOLBG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|