C24H27F3N6O3 — CID 72544196
2-(4-methylpiperazin-1-yl)-N-[[1-(4-nitrophenyl)-3-[4-(trifluoromethoxy)phenyl]pyrazol-5-yl]methyl]ethanamine (PubChem CID 72544196) has the molecular formula C24H27F3N6O3 and a molecular weight of 504.51 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-N-[[1-(4-nitrophenyl)-3-[4-(trifluoromethoxy)phenyl]pyrazol-5-yl]methyl]ethanamine.
| Compound Name | 2-(4-methylpiperazin-1-yl)-N-[[1-(4-nitrophenyl)-3-[4-(trifluoromethoxy)phenyl]pyrazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 72544196 |
| Molecular Formula | C24H27F3N6O3 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-N-[[1-(4-nitrophenyl)-3-[4-(trifluoromethoxy)phenyl]pyrazol-5-yl]methyl]ethanamine |
| SMILES | CN1CCN(CCNCc2cc(-c3ccc(OC(F)(F)F)cc3)nn2-c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C24H27F3N6O3/c1-30-12-14-31(15-13-30)11-10-28-17-21-16-23(18-2-8-22(9-3-18)36-24(25,26)27)29-32(21)19-4-6-20(7-5-19)33(34)35/h2-9,16,28H,10-15,17H2,1H3 |
| InChIKey | SJZPPPOVNVWNSB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|