C24H20F6N2O2 — CID 11634401
4-piperidin-1-yl-2,6-bis[4-(trifluoromethoxy)phenyl]pyridine (PubChem CID 11634401) has the molecular formula C24H20F6N2O2 and a molecular weight of 482.42 g/mol. Its IUPAC name is 4-piperidin-1-yl-2,6-bis[4-(trifluoromethoxy)phenyl]pyridine.
| Compound Name | 4-piperidin-1-yl-2,6-bis[4-(trifluoromethoxy)phenyl]pyridine |
|---|---|
| PubChem CID | 11634401 |
| Molecular Formula | C24H20F6N2O2 |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 4-piperidin-1-yl-2,6-bis[4-(trifluoromethoxy)phenyl]pyridine |
| SMILES | FC(F)(F)Oc1ccc(-c2cc(N3CCCCC3)cc(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C24H20F6N2O2/c25-23(26,27)33-19-8-4-16(5-9-19)21-14-18(32-12-2-1-3-13-32)15-22(31-21)17-6-10-20(11-7-17)34-24(28,29)30/h4-11,14-15H,1-3,12-13H2 |
| InChIKey | ULRVUDBZMPBSBX-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |