C18H19F3N2O — CID 171252024
(S)-(4-pyrrolidin-1-ylphenyl)-[4-(trifluoromethoxy)phenyl]methanamine (PubChem CID 171252024) has the molecular formula C18H19F3N2O and a molecular weight of 336.36 g/mol. Its IUPAC name is (S)-(4-pyrrolidin-1-ylphenyl)-[4-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | (S)-(4-pyrrolidin-1-ylphenyl)-[4-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 171252024 |
| Molecular Formula | C18H19F3N2O |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (S)-(4-pyrrolidin-1-ylphenyl)-[4-(trifluoromethoxy)phenyl]methanamine |
| SMILES | N[C@H](c1ccc(OC(F)(F)F)cc1)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C18H19F3N2O/c19-18(20,21)24-16-9-5-14(6-10-16)17(22)13-3-7-15(8-4-13)23-11-1-2-12-23/h3-10,17H,1-2,11-12,22H2/t17-/m0/s1 |
| InChIKey | FYMGWIKKAJHDJB-KRWDZBQOSA-N |
| XLogP | 4.23 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |