C30H34N4O2 — CID 142679409
2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-N-[[3-(4-phenoxyphenyl)-1,2-oxazol-5-yl]methyl]ethanamine (PubChem CID 142679409) has the molecular formula C30H34N4O2 and a molecular weight of 482.63 g/mol. Its IUPAC name is 2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-N-[[3-(4-phenoxyphenyl)-1,2-oxazol-5-yl]methyl]ethanamine.
| Compound Name | 2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-N-[[3-(4-phenoxyphenyl)-1,2-oxazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 142679409 |
| Molecular Formula | C30H34N4O2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-N-[[3-(4-phenoxyphenyl)-1,2-oxazol-5-yl]methyl]ethanamine |
| SMILES | Cc1ccc(N2CCN(CCNCc3cc(-c4ccc(Oc5ccccc5)cc4)no3)CC2)c(C)c1 |
| InChI | InChI=1S/C30H34N4O2/c1-23-8-13-30(24(2)20-23)34-18-16-33(17-19-34)15-14-31-22-28-21-29(32-36-28)25-9-11-27(12-10-25)35-26-6-4-3-5-7-26/h3-13,20-21,31H,14-19,22H2,1-2H3 |
| InChIKey | LODYNVTZUVWILH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|