C28H29N3O2 — CID 142647992
5-[2-(4-benzylpiperazin-1-yl)ethyl]-3-(3-phenoxyphenyl)-1,2-oxazole (PubChem CID 142647992) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 5-[2-(4-benzylpiperazin-1-yl)ethyl]-3-(3-phenoxyphenyl)-1,2-oxazole.
| Compound Name | 5-[2-(4-benzylpiperazin-1-yl)ethyl]-3-(3-phenoxyphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 142647992 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 5-[2-(4-benzylpiperazin-1-yl)ethyl]-3-(3-phenoxyphenyl)-1,2-oxazole |
| SMILES | c1ccc(CN2CCN(CCc3cc(-c4cccc(Oc5ccccc5)c4)no3)CC2)cc1 |
| InChI | InChI=1S/C28H29N3O2/c1-3-8-23(9-4-1)22-31-18-16-30(17-19-31)15-14-27-21-28(29-33-27)24-10-7-13-26(20-24)32-25-11-5-2-6-12-25/h1-13,20-21H,14-19,22H2 |
| InChIKey | ILWFDYAPHJHCEM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |