C17H16N2O2 — CID 114420236
1-[3-(3-phenoxyphenyl)-1,2-oxazol-5-yl]ethanamine (PubChem CID 114420236) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-[3-(3-phenoxyphenyl)-1,2-oxazol-5-yl]ethanamine.
| Compound Name | 1-[3-(3-phenoxyphenyl)-1,2-oxazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 114420236 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1-[3-(3-phenoxyphenyl)-1,2-oxazol-5-yl]ethanamine |
| SMILES | CC(N)c1cc(-c2cccc(Oc3ccccc3)c2)no1 |
| InChI | InChI=1S/C17H16N2O2/c1-12(18)17-11-16(19-21-17)13-6-5-9-15(10-13)20-14-7-3-2-4-8-14/h2-12H,18H2,1H3 |
| InChIKey | JPLMORDBRQUCBS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |