C17H16N4O3 — CID 167970004
1-[5-(3-phenoxyphenyl)-1,2,4-oxadiazol-3-yl]ethylurea (PubChem CID 167970004) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 1-[5-(3-phenoxyphenyl)-1,2,4-oxadiazol-3-yl]ethylurea.
| Compound Name | 1-[5-(3-phenoxyphenyl)-1,2,4-oxadiazol-3-yl]ethylurea |
|---|---|
| PubChem CID | 167970004 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-[5-(3-phenoxyphenyl)-1,2,4-oxadiazol-3-yl]ethylurea |
| SMILES | CC(NC(N)=O)c1noc(-c2cccc(Oc3ccccc3)c2)n1 |
| InChI | InChI=1S/C17H16N4O3/c1-11(19-17(18)22)15-20-16(24-21-15)12-6-5-9-14(10-12)23-13-7-3-2-4-8-13/h2-11H,1H3,(H3,18,19,22) |
| InChIKey | CGGNOSDZYYYRBX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |