C11H13N3O2 — CID 61326230
1-[5-(3-methoxyphenyl)-1,2,4-oxadiazol-3-yl]ethanamine (PubChem CID 61326230) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-[5-(3-methoxyphenyl)-1,2,4-oxadiazol-3-yl]ethanamine.
| Compound Name | 1-[5-(3-methoxyphenyl)-1,2,4-oxadiazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 61326230 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 1-[5-(3-methoxyphenyl)-1,2,4-oxadiazol-3-yl]ethanamine |
| SMILES | COc1cccc(-c2nc(C(C)N)no2)c1 |
| InChI | InChI=1S/C11H13N3O2/c1-7(12)10-13-11(16-14-10)8-4-3-5-9(6-8)15-2/h3-7H,12H2,1-2H3 |
| InChIKey | YHRWPLKROIZJPR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |