C11H13N3O — CID 10375609
1-[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]ethanamine (PubChem CID 10375609) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 1-[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]ethanamine.
| Compound Name | 1-[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 10375609 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]ethanamine |
| SMILES | Cc1cccc(-c2nc(C(C)N)no2)c1 |
| InChI | InChI=1S/C11H13N3O/c1-7-4-3-5-9(6-7)11-13-10(8(2)12)14-15-11/h3-6,8H,12H2,1-2H3 |
| InChIKey | FMSGBDLRGHGMPH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |