C10H11N3O — CID 82404680
1-(3-pyridin-2-yl-1,2-oxazol-5-yl)ethanamine (PubChem CID 82404680) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 1-(3-pyridin-2-yl-1,2-oxazol-5-yl)ethanamine.
| Compound Name | 1-(3-pyridin-2-yl-1,2-oxazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 82404680 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 1-(3-pyridin-2-yl-1,2-oxazol-5-yl)ethanamine |
| SMILES | CC(N)c1cc(-c2ccccn2)no1 |
| InChI | InChI=1S/C10H11N3O/c1-7(11)10-6-9(13-14-10)8-4-2-3-5-12-8/h2-7H,11H2,1H3 |
| InChIKey | UPHWAQGPNUUYHI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |