C20H24N4OS — CID 10133646
5-[3-(4-benzylpiperazin-1-yl)propyl]-3-(1,3-thiazol-2-yl)-1,2-oxazole (PubChem CID 10133646) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is 5-[3-(4-benzylpiperazin-1-yl)propyl]-3-(1,3-thiazol-2-yl)-1,2-oxazole.
| Compound Name | 5-[3-(4-benzylpiperazin-1-yl)propyl]-3-(1,3-thiazol-2-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 10133646 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 5-[3-(4-benzylpiperazin-1-yl)propyl]-3-(1,3-thiazol-2-yl)-1,2-oxazole |
| SMILES | c1ccc(CN2CCN(CCCc3cc(-c4nccs4)no3)CC2)cc1 |
| InChI | InChI=1S/C20H24N4OS/c1-2-5-17(6-3-1)16-24-12-10-23(11-13-24)9-4-7-18-15-19(22-25-18)20-21-8-14-26-20/h1-3,5-6,8,14-15H,4,7,9-13,16H2 |
| InChIKey | AVAVSXWDHUPOCE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |