C26H29N7OS — CID 20741362
N-[3-[3-[4-(pyridin-4-ylmethyl)piperazin-1-yl]propoxy]phenyl]-4-(1,3-thiazol-2-yl)pyrimidin-2-amine (PubChem CID 20741362) has the molecular formula C26H29N7OS and a molecular weight of 487.63 g/mol. Its IUPAC name is N-[3-[3-[4-(pyridin-4-ylmethyl)piperazin-1-yl]propoxy]phenyl]-4-(1,3-thiazol-2-yl)pyrimidin-2-amine.
| Compound Name | N-[3-[3-[4-(pyridin-4-ylmethyl)piperazin-1-yl]propoxy]phenyl]-4-(1,3-thiazol-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 20741362 |
| Molecular Formula | C26H29N7OS |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | N-[3-[3-[4-(pyridin-4-ylmethyl)piperazin-1-yl]propoxy]phenyl]-4-(1,3-thiazol-2-yl)pyrimidin-2-amine |
| SMILES | c1cc(Nc2nccc(-c3nccs3)n2)cc(OCCCN2CCN(Cc3ccncc3)CC2)c1 |
| InChI | InChI=1S/C26H29N7OS/c1-3-22(30-26-29-10-7-24(31-26)25-28-11-18-35-25)19-23(4-1)34-17-2-12-32-13-15-33(16-14-32)20-21-5-8-27-9-6-21/h1,3-11,18-19H,2,12-17,20H2,(H,29,30,31) |
| InChIKey | WTKRWKIIEDFTFW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|