C19H17N5O5PS-3 — CID 19811563
N-[3-(2-imidazol-1-ylethoxy)phenyl]-4-thiophen-2-ylpyrimidin-2-amine phosphate (PubChem CID 19811563) has the molecular formula C19H17N5O5PS-3 and a molecular weight of 458.42 g/mol. Its IUPAC name is N-[3-(2-imidazol-1-ylethoxy)phenyl]-4-thiophen-2-ylpyrimidin-2-amine phosphate.
| Compound Name | N-[3-(2-imidazol-1-ylethoxy)phenyl]-4-thiophen-2-ylpyrimidin-2-amine phosphate |
|---|---|
| PubChem CID | 19811563 |
| Molecular Formula | C19H17N5O5PS-3 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | N-[3-(2-imidazol-1-ylethoxy)phenyl]-4-thiophen-2-ylpyrimidin-2-amine phosphate |
| SMILES | O=P([O-])([O-])[O-].c1cc(Nc2nccc(-c3cccs3)n2)cc(OCCn2ccnc2)c1 |
| InChI | InChI=1S/C19H17N5OS.H3O4P/c1-3-15(13-16(4-1)25-11-10-24-9-8-20-14-24)22-19-21-7-6-17(23-19)18-5-2-12-26-18;1-5(2,3)4/h1-9,12-14H,10-11H2,(H,21,22,23);(H3,1,2,3,4)/p-3 |
| InChIKey | KGGPJQXYNSXCQC-UHFFFAOYSA-K |
| XLogP | 1.40 |
| TPSA | 151.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|