C22H22ClN7 — CID 24991254
N-(3-chlorophenyl)-4-[2-(3-imidazol-1-ylpropylamino)-3-methyl-4-pyridinyl]pyrimidin-2-amine (PubChem CID 24991254) has the molecular formula C22H22ClN7 and a molecular weight of 419.92 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[2-(3-imidazol-1-ylpropylamino)-3-methyl-4-pyridinyl]pyrimidin-2-amine.
| Compound Name | N-(3-chlorophenyl)-4-[2-(3-imidazol-1-ylpropylamino)-3-methyl-4-pyridinyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 24991254 |
| Molecular Formula | C22H22ClN7 |
| Molecular Weight | 419.92 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N-(3-chlorophenyl)-4-[2-(3-imidazol-1-ylpropylamino)-3-methyl-4-pyridinyl]pyrimidin-2-amine |
| SMILES | Cc1c(-c2ccnc(Nc3cccc(Cl)c3)n2)ccnc1NCCCn1ccnc1 |
| InChI | InChI=1S/C22H22ClN7/c1-16-19(6-9-26-21(16)25-8-3-12-30-13-11-24-15-30)20-7-10-27-22(29-20)28-18-5-2-4-17(23)14-18/h2,4-7,9-11,13-15H,3,8,12H2,1H3,(H,25,26)(H,27,28,29) |
| InChIKey | AZYAPTCAEGBEPK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.92 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|