C11H15ClN6 — CID 80753932
5-chloro-4-N-(3-imidazol-1-ylpropyl)-2-N-methylpyrimidine-2,4-diamine (PubChem CID 80753932) has the molecular formula C11H15ClN6 and a molecular weight of 266.74 g/mol. Its IUPAC name is 5-chloro-4-N-(3-imidazol-1-ylpropyl)-2-N-methylpyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(3-imidazol-1-ylpropyl)-2-N-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80753932 |
| Molecular Formula | C11H15ClN6 |
| Molecular Weight | 266.74 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 5-chloro-4-N-(3-imidazol-1-ylpropyl)-2-N-methylpyrimidine-2,4-diamine |
| SMILES | CNc1ncc(Cl)c(NCCCn2ccnc2)n1 |
| InChI | InChI=1S/C11H15ClN6/c1-13-11-16-7-9(12)10(17-11)15-3-2-5-18-6-4-14-8-18/h4,6-8H,2-3,5H2,1H3,(H2,13,15,16,17) |
| InChIKey | RNRDRYLTBPOBNV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.74 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|