C10H15N5 — CID 62132911
N-(3-imidazol-1-ylpropyl)-1-methylimidazol-2-amine (PubChem CID 62132911) has the molecular formula C10H15N5 and a molecular weight of 205.27 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-1-methylimidazol-2-amine.
| Compound Name | N-(3-imidazol-1-ylpropyl)-1-methylimidazol-2-amine |
|---|---|
| PubChem CID | 62132911 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.27 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-1-methylimidazol-2-amine |
| SMILES | Cn1ccnc1NCCCn1ccnc1 |
| InChI | InChI=1S/C10H15N5/c1-14-7-5-13-10(14)12-3-2-6-15-8-4-11-9-15/h4-5,7-9H,2-3,6H2,1H3,(H,12,13) |
| InChIKey | FWKCRYBGOXKLQO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|