C12H18N6 — CID 80753525
6-N-ethyl-4-N-(3-imidazol-1-ylpropyl)pyrimidine-4,6-diamine (PubChem CID 80753525) has the molecular formula C12H18N6 and a molecular weight of 246.32 g/mol. Its IUPAC name is 6-N-ethyl-4-N-(3-imidazol-1-ylpropyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-ethyl-4-N-(3-imidazol-1-ylpropyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80753525 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 6-N-ethyl-4-N-(3-imidazol-1-ylpropyl)pyrimidine-4,6-diamine |
| SMILES | CCNc1cc(NCCCn2ccnc2)ncn1 |
| InChI | InChI=1S/C12H18N6/c1-2-14-11-8-12(17-9-16-11)15-4-3-6-18-7-5-13-10-18/h5,7-10H,2-4,6H2,1H3,(H2,14,15,16,17) |
| InChIKey | VELJXBWMPITKHG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|