C13H18N8 — CID 114784854
6-N-(4-imidazol-1-ylbutyl)-2-N-methyl-7H-purine-2,6-diamine (PubChem CID 114784854) has the molecular formula C13H18N8 and a molecular weight of 286.34 g/mol. Its IUPAC name is 6-N-(4-imidazol-1-ylbutyl)-2-N-methyl-7H-purine-2,6-diamine.
| Compound Name | 6-N-(4-imidazol-1-ylbutyl)-2-N-methyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114784854 |
| Molecular Formula | C13H18N8 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 6-N-(4-imidazol-1-ylbutyl)-2-N-methyl-7H-purine-2,6-diamine |
| SMILES | CNc1nc(NCCCCn2ccnc2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H18N8/c1-14-13-19-11(10-12(20-13)18-8-17-10)16-4-2-3-6-21-7-5-15-9-21/h5,7-9H,2-4,6H2,1H3,(H3,14,16,17,18,19,20) |
| InChIKey | MYSVPMQBRLFRDV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|