C9H15N7O2S — CID 106343102
N-methyl-2-[[2-(methylamino)-7H-purin-6-yl]amino]ethanesulfonamide (PubChem CID 106343102) has the molecular formula C9H15N7O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is N-methyl-2-[[2-(methylamino)-7H-purin-6-yl]amino]ethanesulfonamide.
| Compound Name | N-methyl-2-[[2-(methylamino)-7H-purin-6-yl]amino]ethanesulfonamide |
|---|---|
| PubChem CID | 106343102 |
| Molecular Formula | C9H15N7O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N-methyl-2-[[2-(methylamino)-7H-purin-6-yl]amino]ethanesulfonamide |
| SMILES | CNc1nc(NCCS(=O)(=O)NC)c2[nH]cnc2n1 |
| InChI | InChI=1S/C9H15N7O2S/c1-10-9-15-7(6-8(16-9)14-5-13-6)12-3-4-19(17,18)11-2/h5,11H,3-4H2,1-2H3,(H3,10,12,13,14,15,16) |
| InChIKey | ILKWEYRSYARVGG-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |