C10H16N6OS — CID 114786408
2-N-methyl-6-N-(3-methylsulfinylpropyl)-7H-purine-2,6-diamine (PubChem CID 114786408) has the molecular formula C10H16N6OS and a molecular weight of 268.35 g/mol. Its IUPAC name is 2-N-methyl-6-N-(3-methylsulfinylpropyl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-methyl-6-N-(3-methylsulfinylpropyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114786408 |
| Molecular Formula | C10H16N6OS |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-N-methyl-6-N-(3-methylsulfinylpropyl)-7H-purine-2,6-diamine |
| SMILES | CNc1nc(NCCCS(C)=O)c2[nH]cnc2n1 |
| InChI | InChI=1S/C10H16N6OS/c1-11-10-15-8(12-4-3-5-18(2)17)7-9(16-10)14-6-13-7/h6H,3-5H2,1-2H3,(H3,11,12,13,14,15,16) |
| InChIKey | OEZYBVDXLYAPIK-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|