About CID 89325166
CID 89325166 (PubChem CID 89325166) has the molecular formula C24H26N7O2S-
and a molecular weight of 476.59 g/mol.
Molecular Properties
| Compound Name | CID 89325166 |
| PubChem CID | 89325166 |
| Molecular Formula | C24H26N7O2S- |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/c1cccc(Nc2ncc(-c3ccc(OCC)cc3)c(NCCCn3ccnc3)n2)c1 |
| InChI | InChI=1S/C24H26N7O2S/c1-2-33-20-9-7-18(8-10-20)22-16-28-24(29-19-5-3-6-21(15-19)34(25)32)30-23(22)27-11-4-13-31-14-12-26-17-31/h3,5-10,12,14-17,25H,2,4,11,13H2,1H3,(H2,27,28,29,30)/q-1 |
| InChIKey | BWQPTHVJPUPOGA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 89325166 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89325166?
The IUPAC name of CID 89325166 (CID 89325166) is not available.
What is the SMILES notation for CID 89325166?
The canonical SMILES for CID 89325166 is [H]/N=[S-](=O)/c1cccc(Nc2ncc(-c3ccc(OCC)cc3)c(NCCCn3ccnc3)n2)c1.
What is the InChIKey of CID 89325166?
The InChIKey is BWQPTHVJPUPOGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N7O2S/c1-2-33-20-9-7-18(8-10-20)22-16-28-24(29-19-5-3-6-21(15-19)34(25)32)30-23(22)27-11-4-13-31-14-12-26-17-31/h3,5-10,12,14-17,25H,2,4,11,13H2,1H3,(H2,27,28,29,30)/q-1.
What are the key properties of CID 89325166?
CID 89325166 has a molecular weight of 476.59 g/mol, XLogP of 5.07, 11 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89325166 is sourced from PubChem (CID 89325166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).