C24H26N7O2S- — CID 89325166
CID 89325166 (PubChem CID 89325166) has the molecular formula C24H26N7O2S- and a molecular weight of 476.59 g/mol.
| Compound Name | CID 89325166 |
|---|---|
| PubChem CID | 89325166 |
| Molecular Formula | C24H26N7O2S- |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/c1cccc(Nc2ncc(-c3ccc(OCC)cc3)c(NCCCn3ccnc3)n2)c1 |
| InChI | InChI=1S/C24H26N7O2S/c1-2-33-20-9-7-18(8-10-20)22-16-28-24(29-19-5-3-6-21(15-19)34(25)32)30-23(22)27-11-4-13-31-14-12-26-17-31/h3,5-10,12,14-17,25H,2,4,11,13H2,1H3,(H2,27,28,29,30)/q-1 |
| InChIKey | BWQPTHVJPUPOGA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|